C25H38O7 — CID 123474048
[(2R,3S,4R)-3,4,5,5-tetrahydroxyoxolan-2-yl]methyl icosa-5,8,11,14,17-pentaenoate (PubChem CID 123474048) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4,5,5-tetrahydroxyoxolan-2-yl]methyl icosa-5,8,11,14,17-pentaenoate.
| Compound Name | [(2R,3S,4R)-3,4,5,5-tetrahydroxyoxolan-2-yl]methyl icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 123474048 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | [(2R,3S,4R)-3,4,5,5-tetrahydroxyoxolan-2-yl]methyl icosa-5,8,11,14,17-pentaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC[C@H]1OC(O)(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H38O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(26)31-20-21-23(27)24(28)25(29,30)32-21/h3-4,6-7,9-10,12-13,15-16,21,23-24,27-30H,2,5,8,11,14,17-20H2,1H3/t21-,23-,24-/m1/s1 |
| InChIKey | RPCRHFCVHLWZRL-GMKZXUHWSA-N |
| XLogP | 3.21 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|