C16H23F2N3O6 — CID 90156646
hexyl N-[3-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 90156646) has the molecular formula C16H23F2N3O6 and a molecular weight of 391.37 g/mol. Its IUPAC name is hexyl N-[3-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | hexyl N-[3-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 90156646 |
| Molecular Formula | C16H23F2N3O6 |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | hexyl N-[3-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCCCCCOC(=O)Nc1ccnc(=O)n1[C@@H]1O[C@H](CO)[C@@H](O)C1(F)F |
| InChI | InChI=1S/C16H23F2N3O6/c1-2-3-4-5-8-26-15(25)20-11-6-7-19-14(24)21(11)13-16(17,18)12(23)10(9-22)27-13/h6-7,10,12-13,22-23H,2-5,8-9H2,1H3,(H,20,25)/t10-,12-,13-/m1/s1 |
| InChIKey | RCCGLLZVGQYZPN-RAIGVLPGSA-N |
| XLogP | 1.26 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|