C13H18FN3O5S — CID 142440988
butyl N-[5-fluoro-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]carbamate (PubChem CID 142440988) has the molecular formula C13H18FN3O5S and a molecular weight of 347.37 g/mol. Its IUPAC name is butyl N-[5-fluoro-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | butyl N-[5-fluoro-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 142440988 |
| Molecular Formula | C13H18FN3O5S |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | butyl N-[5-fluoro-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCCCOC(=O)Nc1nc(=O)n([C@@H]2CS[C@H](CO)O2)cc1F |
| InChI | InChI=1S/C13H18FN3O5S/c1-2-3-4-21-13(20)16-11-8(14)5-17(12(19)15-11)9-7-23-10(6-18)22-9/h5,9-10,18H,2-4,6-7H2,1H3,(H,15,16,19,20)/t9-,10+/m0/s1 |
| InChIKey | NCWSDWHXMBBGNT-VHSXEESVSA-N |
| XLogP | 1.31 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|