C15H20FN3O6 — CID 91014527
pentyl N-[5-fluoro-1-(5-formyl-4-hydroxyoxolan-2-yl)-2-oxopyrimidin-4-yl]carbamate (PubChem CID 91014527) has the molecular formula C15H20FN3O6 and a molecular weight of 357.34 g/mol. Its IUPAC name is pentyl N-[5-fluoro-1-(5-formyl-4-hydroxyoxolan-2-yl)-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | pentyl N-[5-fluoro-1-(5-formyl-4-hydroxyoxolan-2-yl)-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 91014527 |
| Molecular Formula | C15H20FN3O6 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | pentyl N-[5-fluoro-1-(5-formyl-4-hydroxyoxolan-2-yl)-2-oxopyrimidin-4-yl]carbamate |
| SMILES | CCCCCOC(=O)Nc1nc(=O)n(C2CC(O)C(C=O)O2)cc1F |
| InChI | InChI=1S/C15H20FN3O6/c1-2-3-4-5-24-15(23)18-13-9(16)7-19(14(22)17-13)12-6-10(21)11(8-20)25-12/h7-8,10-12,21H,2-6H2,1H3,(H,17,18,22,23) |
| InChIKey | SNFKVTHNYIEWAT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|