C15H22FN3O6 — CID 50915977
pentyl N-[5-fluoro-2-oxo-1-[(2R,3R,4S,5R)-2,3,4,5-tetradeuterio-3,4-dihydroxy-5-methyloxolan-2-yl]pyrimidin-4-yl]carbamate (PubChem CID 50915977) has the molecular formula C15H22FN3O6 and a molecular weight of 363.38 g/mol. Its IUPAC name is pentyl N-[5-fluoro-2-oxo-1-[(2R,3R,4S,5R)-2,3,4,5-tetradeuterio-3,4-dihydroxy-5-methyloxolan-2-yl]pyrimidin-4-yl]carbamate.
| Compound Name | pentyl N-[5-fluoro-2-oxo-1-[(2R,3R,4S,5R)-2,3,4,5-tetradeuterio-3,4-dihydroxy-5-methyloxolan-2-yl]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 50915977 |
| Molecular Formula | C15H22FN3O6 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | pentyl N-[5-fluoro-2-oxo-1-[(2R,3R,4S,5R)-2,3,4,5-tetradeuterio-3,4-dihydroxy-5-methyloxolan-2-yl]pyrimidin-4-yl]carbamate |
| SMILES | [2H][C@]1(O)[C@@]([2H])(O)[C@]([2H])(n2cc(F)c(NC(=O)OCCCCC)nc2=O)O[C@]1([2H])C |
| InChI | InChI=1S/C15H22FN3O6/c1-3-4-5-6-24-15(23)18-12-9(16)7-19(14(22)17-12)13-11(21)10(20)8(2)25-13/h7-8,10-11,13,20-21H,3-6H2,1-2H3,(H,17,18,22,23)/t8-,10-,11-,13-/m1/s1/i8D,10D,11D,13D |
| InChIKey | GAGWJHPBXLXJQN-YMCYKKSASA-N |
| XLogP | 0.76 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|