C17H24FN3O6S — CID 135347193
[(2R,5S)-5-[5-fluoro-4-(hexoxycarbonylamino)-2-oxopyrimidin-1-yl]-1,3-oxathiolan-2-yl]methyl acetate (PubChem CID 135347193) has the molecular formula C17H24FN3O6S and a molecular weight of 417.46 g/mol. Its IUPAC name is [(2R,5S)-5-[5-fluoro-4-(hexoxycarbonylamino)-2-oxopyrimidin-1-yl]-1,3-oxathiolan-2-yl]methyl acetate.
| Compound Name | [(2R,5S)-5-[5-fluoro-4-(hexoxycarbonylamino)-2-oxopyrimidin-1-yl]-1,3-oxathiolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135347193 |
| Molecular Formula | C17H24FN3O6S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | [(2R,5S)-5-[5-fluoro-4-(hexoxycarbonylamino)-2-oxopyrimidin-1-yl]-1,3-oxathiolan-2-yl]methyl acetate |
| SMILES | CCCCCCOC(=O)Nc1nc(=O)n([C@@H]2CS[C@H](COC(C)=O)O2)cc1F |
| InChI | InChI=1S/C17H24FN3O6S/c1-3-4-5-6-7-25-17(24)20-15-12(18)8-21(16(23)19-15)13-10-28-14(27-13)9-26-11(2)22/h8,13-14H,3-7,9-10H2,1-2H3,(H,19,20,23,24)/t13-,14+/m0/s1 |
| InChIKey | KOJRRFKQVNHISE-UONOGXRCSA-N |
| XLogP | 2.66 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|