C27H42FN3O8S — CID 154944073
methyl 4-[(2S,5R)-5-[4-(decoxycarbonylamino)-5-fluoro-2-oxopyrimidin-1-yl]-1,3-oxathiolan-2-yl]-2,2,5-trimethyl-1,3-dioxane-5-carboxylate (PubChem CID 154944073) has the molecular formula C27H42FN3O8S and a molecular weight of 587.71 g/mol. Its IUPAC name is methyl 4-[(2S,5R)-5-[4-(decoxycarbonylamino)-5-fluoro-2-oxopyrimidin-1-yl]-1,3-oxathiolan-2-yl]-2,2,5-trimethyl-1,3-dioxane-5-carboxylate.
| Compound Name | methyl 4-[(2S,5R)-5-[4-(decoxycarbonylamino)-5-fluoro-2-oxopyrimidin-1-yl]-1,3-oxathiolan-2-yl]-2,2,5-trimethyl-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 154944073 |
| Molecular Formula | C27H42FN3O8S |
| Molecular Weight | 587.71 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | methyl 4-[(2S,5R)-5-[4-(decoxycarbonylamino)-5-fluoro-2-oxopyrimidin-1-yl]-1,3-oxathiolan-2-yl]-2,2,5-trimethyl-1,3-dioxane-5-carboxylate |
| SMILES | CCCCCCCCCCOC(=O)Nc1nc(=O)n([C@H]2CS[C@@H](C3OC(C)(C)OCC3(C)C(=O)OC)O2)cc1F |
| InChI | InChI=1S/C27H42FN3O8S/c1-6-7-8-9-10-11-12-13-14-36-25(34)30-21-18(28)15-31(24(33)29-21)19-16-40-22(38-19)20-27(4,23(32)35-5)17-37-26(2,3)39-20/h15,19-20,22H,6-14,16-17H2,1-5H3,(H,29,30,33,34)/t19-,20?,22+,27?/m1/s1 |
| InChIKey | UCBXTQOSEXXXDK-XEVMSFHDSA-N |
| XLogP | 4.99 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.71 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|