C29H30FN3O8 — CID 53233201
[(2R,3R,4R,5R)-4-benzoyloxy-5-[5-fluoro-2-oxo-4-(pentoxycarbonylamino)pyrimidin-1-yl]-2-methyloxolan-3-yl] benzoate (PubChem CID 53233201) has the molecular formula C29H30FN3O8 and a molecular weight of 567.57 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-benzoyloxy-5-[5-fluoro-2-oxo-4-(pentoxycarbonylamino)pyrimidin-1-yl]-2-methyloxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,5R)-4-benzoyloxy-5-[5-fluoro-2-oxo-4-(pentoxycarbonylamino)pyrimidin-1-yl]-2-methyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 53233201 |
| Molecular Formula | C29H30FN3O8 |
| Molecular Weight | 567.57 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | [(2R,3R,4R,5R)-4-benzoyloxy-5-[5-fluoro-2-oxo-4-(pentoxycarbonylamino)pyrimidin-1-yl]-2-methyloxolan-3-yl] benzoate |
| SMILES | CCCCCOC(=O)Nc1nc(=O)n([C@@H]2O[C@H](C)[C@@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)cc1F |
| InChI | InChI=1S/C29H30FN3O8/c1-3-4-11-16-38-29(37)32-24-21(30)17-33(28(36)31-24)25-23(41-27(35)20-14-9-6-10-15-20)22(18(2)39-25)40-26(34)19-12-7-5-8-13-19/h5-10,12-15,17-18,22-23,25H,3-4,11,16H2,1-2H3,(H,31,32,36,37)/t18-,22-,23-,25-/m1/s1 |
| InChIKey | QDFCNXXFCSRYON-FQESCDNSSA-N |
| XLogP | 4.49 |
| TPSA | 135.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|