C23H36FN9O8 — CID 118492962
[(2R,3R,4R,5R)-4-[3-(diaminomethylideneamino)propanoyloxy]-5-[5-fluoro-2-oxo-4-(pentoxycarbonylamino)pyrimidin-1-yl]-2-methyloxolan-3-yl] 3-(diaminomethylideneamino)propanoate (PubChem CID 118492962) has the molecular formula C23H36FN9O8 and a molecular weight of 585.59 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-[3-(diaminomethylideneamino)propanoyloxy]-5-[5-fluoro-2-oxo-4-(pentoxycarbonylamino)pyrimidin-1-yl]-2-methyloxolan-3-yl] 3-(diaminomethylideneamino)propanoate.
| Compound Name | [(2R,3R,4R,5R)-4-[3-(diaminomethylideneamino)propanoyloxy]-5-[5-fluoro-2-oxo-4-(pentoxycarbonylamino)pyrimidin-1-yl]-2-methyloxolan-3-yl] 3-(diaminomethylideneamino)propanoate |
|---|---|
| PubChem CID | 118492962 |
| Molecular Formula | C23H36FN9O8 |
| Molecular Weight | 585.59 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | [(2R,3R,4R,5R)-4-[3-(diaminomethylideneamino)propanoyloxy]-5-[5-fluoro-2-oxo-4-(pentoxycarbonylamino)pyrimidin-1-yl]-2-methyloxolan-3-yl] 3-(diaminomethylideneamino)propanoate |
| SMILES | CCCCCOC(=O)Nc1nc(=O)n([C@@H]2O[C@H](C)[C@@H](OC(=O)CCN=C(N)N)[C@H]2OC(=O)CCN=C(N)N)cc1F |
| InChI | InChI=1S/C23H36FN9O8/c1-3-4-5-10-38-23(37)32-18-13(24)11-33(22(36)31-18)19-17(41-15(35)7-9-30-21(27)28)16(12(2)39-19)40-14(34)6-8-29-20(25)26/h11-12,16-17,19H,3-10H2,1-2H3,(H4,25,26,29)(H4,27,28,30)(H,31,32,36,37)/t12-,16-,17-,19-/m1/s1 |
| InChIKey | YCLNBVRWBAUOAQ-MYFFOXHASA-N |
| XLogP | -0.81 |
| TPSA | 263.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.59 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|