C21H24FN3O8 — CID 67421367
[(2R,3R,4R,5R)-4-but-3-enoyloxy-5-[5-fluoro-2-oxo-4-(prop-2-enoxycarbonylamino)pyrimidin-1-yl]-2-methyloxolan-3-yl] but-3-enoate (PubChem CID 67421367) has the molecular formula C21H24FN3O8 and a molecular weight of 465.43 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-but-3-enoyloxy-5-[5-fluoro-2-oxo-4-(prop-2-enoxycarbonylamino)pyrimidin-1-yl]-2-methyloxolan-3-yl] but-3-enoate.
| Compound Name | [(2R,3R,4R,5R)-4-but-3-enoyloxy-5-[5-fluoro-2-oxo-4-(prop-2-enoxycarbonylamino)pyrimidin-1-yl]-2-methyloxolan-3-yl] but-3-enoate |
|---|---|
| PubChem CID | 67421367 |
| Molecular Formula | C21H24FN3O8 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | [(2R,3R,4R,5R)-4-but-3-enoyloxy-5-[5-fluoro-2-oxo-4-(prop-2-enoxycarbonylamino)pyrimidin-1-yl]-2-methyloxolan-3-yl] but-3-enoate |
| SMILES | C=CCOC(=O)Nc1nc(=O)n([C@@H]2O[C@H](C)[C@@H](OC(=O)CC=C)[C@H]2OC(=O)CC=C)cc1F |
| InChI | InChI=1S/C21H24FN3O8/c1-5-8-14(26)32-16-12(4)31-19(17(16)33-15(27)9-6-2)25-11-13(22)18(23-20(25)28)24-21(29)30-10-7-3/h5-7,11-12,16-17,19H,1-3,8-10H2,4H3,(H,23,24,28,29)/t12-,16-,17-,19-/m1/s1 |
| InChIKey | RDGWEAUYHJQVKM-MYFFOXHASA-N |
| XLogP | 2.01 |
| TPSA | 135.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|