C19H24IN3O9 — CID 70022242
[(2R,3R,4R,5R)-4-acetyloxy-5-[5-iodo-2-oxo-4-(4-oxopentoxycarbonylamino)pyrimidin-1-yl]-2-methyloxolan-3-yl] acetate (PubChem CID 70022242) has the molecular formula C19H24IN3O9 and a molecular weight of 565.32 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-acetyloxy-5-[5-iodo-2-oxo-4-(4-oxopentoxycarbonylamino)pyrimidin-1-yl]-2-methyloxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-4-acetyloxy-5-[5-iodo-2-oxo-4-(4-oxopentoxycarbonylamino)pyrimidin-1-yl]-2-methyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 70022242 |
| Molecular Formula | C19H24IN3O9 |
| Molecular Weight | 565.32 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | [(2R,3R,4R,5R)-4-acetyloxy-5-[5-iodo-2-oxo-4-(4-oxopentoxycarbonylamino)pyrimidin-1-yl]-2-methyloxolan-3-yl] acetate |
| SMILES | CC(=O)CCCOC(=O)Nc1nc(=O)n([C@@H]2O[C@H](C)[C@@H](OC(C)=O)[C@H]2OC(C)=O)cc1I |
| InChI | InChI=1S/C19H24IN3O9/c1-9(24)6-5-7-29-19(28)22-16-13(20)8-23(18(27)21-16)17-15(32-12(4)26)14(10(2)30-17)31-11(3)25/h8,10,14-15,17H,5-7H2,1-4H3,(H,21,22,27,28)/t10-,14-,15-,17-/m1/s1 |
| InChIKey | VLCAGTLBBSGIPN-GWBBYGMBSA-N |
| XLogP | 1.55 |
| TPSA | 152.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|