C17H24FN3O7S — CID 135347139
[5-fluoro-1-[(2R,5S)-2-(heptoxycarbonyloxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]carbamic acid (PubChem CID 135347139) has the molecular formula C17H24FN3O7S and a molecular weight of 433.46 g/mol. Its IUPAC name is [5-fluoro-1-[(2R,5S)-2-(heptoxycarbonyloxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]carbamic acid.
| Compound Name | [5-fluoro-1-[(2R,5S)-2-(heptoxycarbonyloxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 135347139 |
| Molecular Formula | C17H24FN3O7S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | [5-fluoro-1-[(2R,5S)-2-(heptoxycarbonyloxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]carbamic acid |
| SMILES | CCCCCCCOC(=O)OC[C@@H]1O[C@H](n2cc(F)c(NC(=O)O)nc2=O)CS1 |
| InChI | InChI=1S/C17H24FN3O7S/c1-2-3-4-5-6-7-26-17(25)27-9-13-28-12(10-29-13)21-8-11(18)14(19-15(21)22)20-16(23)24/h8,12-13H,2-7,9-10H2,1H3,(H,23,24)(H,19,20,22)/t12-,13+/m0/s1 |
| InChIKey | XTCQDEPDSVNJSA-QWHCGFSZSA-N |
| XLogP | 3.18 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|