About 4-(diethylamino)-1-[(2R,5S)-2-(propoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one
4-(diethylamino)-1-[(2R,5S)-2-(propoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one (PubChem CID 171600940) has the molecular formula C15H25N3O3S
and a molecular weight of 327.45 g/mol. Its IUPAC name is 4-(diethylamino)-1-[(2R,5S)-2-(propoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-(diethylamino)-1-[(2R,5S)-2-(propoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one |
| PubChem CID | 171600940 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 4-(diethylamino)-1-[(2R,5S)-2-(propoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one |
| SMILES | CCCOC[C@@H]1O[C@H](n2ccc(N(CC)CC)nc2=O)CS1 |
| InChI | InChI=1S/C15H25N3O3S/c1-4-9-20-10-14-21-13(11-22-14)18-8-7-12(16-15(18)19)17(5-2)6-3/h7-8,13-14H,4-6,9-11H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | VLWIOEIAMMWHDH-UONOGXRCSA-N |
| XLogP | 2.10 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethylamino)-1-[(2R,5S)-2-(propoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethylamino)-1-[(2R,5S)-2-(propoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one?
The IUPAC name of 4-(diethylamino)-1-[(2R,5S)-2-(propoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one (CID 171600940) is 4-(diethylamino)-1-[(2R,5S)-2-(propoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one.
What is the SMILES notation for 4-(diethylamino)-1-[(2R,5S)-2-(propoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one?
The canonical SMILES for 4-(diethylamino)-1-[(2R,5S)-2-(propoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one is CCCOC[C@@H]1O[C@H](n2ccc(N(CC)CC)nc2=O)CS1.
What is the InChIKey of 4-(diethylamino)-1-[(2R,5S)-2-(propoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one?
The InChIKey is VLWIOEIAMMWHDH-UONOGXRCSA-N. The full InChI is InChI=1S/C15H25N3O3S/c1-4-9-20-10-14-21-13(11-22-14)18-8-7-12(16-15(18)19)17(5-2)6-3/h7-8,13-14H,4-6,9-11H2,1-3H3/t13-,14+/m0/s1.
What are the key properties of 4-(diethylamino)-1-[(2R,5S)-2-(propoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one?
4-(diethylamino)-1-[(2R,5S)-2-(propoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one has a molecular weight of 327.45 g/mol, XLogP of 2.10, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethylamino)-1-[(2R,5S)-2-(propoxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one is sourced from PubChem (CID 171600940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).