C23H29N3O5SSeSi — CID 135062275
N-[1-[(4R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-sulfanylidene-3a,4,6,6a-tetrahydroselenopheno[3,4-d][1,3]dioxol-4-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 135062275) has the molecular formula C23H29N3O5SSeSi and a molecular weight of 566.61 g/mol. Its IUPAC name is N-[1-[(4R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-sulfanylidene-3a,4,6,6a-tetrahydroselenopheno[3,4-d][1,3]dioxol-4-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(4R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-sulfanylidene-3a,4,6,6a-tetrahydroselenopheno[3,4-d][1,3]dioxol-4-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 135062275 |
| Molecular Formula | C23H29N3O5SSeSi |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 567.08 |
| IUPAC Name | N-[1-[(4R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-sulfanylidene-3a,4,6,6a-tetrahydroselenopheno[3,4-d][1,3]dioxol-4-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1[Se][C@@H](n2ccc(NC(=O)c3ccccc3)nc2=O)C2OC(=S)OC21 |
| InChI | InChI=1S/C23H29N3O5SSeSi/c1-23(2,3)34(4,5)29-13-15-17-18(31-22(32)30-17)20(33-15)26-12-11-16(25-21(26)28)24-19(27)14-9-7-6-8-10-14/h6-12,15,17-18,20H,13H2,1-5H3,(H,24,25,27,28)/t15-,17?,18?,20-/m1/s1 |
| InChIKey | SMFNMPILVSSVKL-CNXCKVANSA-N |
| XLogP | 3.59 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|