C31H49FN3O7PSi — CID 176801479
[(2R,3R,5R)-3-(4-benzamido-2-oxopyrimidin-1-yl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorocyclopentyl] dibutyl phosphate (PubChem CID 176801479) has the molecular formula C31H49FN3O7PSi and a molecular weight of 653.81 g/mol. Its IUPAC name is [(2R,3R,5R)-3-(4-benzamido-2-oxopyrimidin-1-yl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorocyclopentyl] dibutyl phosphate.
| Compound Name | [(2R,3R,5R)-3-(4-benzamido-2-oxopyrimidin-1-yl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorocyclopentyl] dibutyl phosphate |
|---|---|
| PubChem CID | 176801479 |
| Molecular Formula | C31H49FN3O7PSi |
| Molecular Weight | 653.81 g/mol |
| Exact Mass | 653.31 |
| IUPAC Name | [(2R,3R,5R)-3-(4-benzamido-2-oxopyrimidin-1-yl)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-fluorocyclopentyl] dibutyl phosphate |
| SMILES | CCCCOP(=O)(OCCCC)OC1[C@@H](CO[Si](C)(C)C(C)(C)C)C[C@@H](n2ccc(NC(=O)c3ccccc3)nc2=O)[C@H]1F |
| InChI | InChI=1S/C31H49FN3O7PSi/c1-8-10-19-39-43(38,40-20-11-9-2)42-28-24(22-41-44(6,7)31(3,4)5)21-25(27(28)32)35-18-17-26(34-30(35)37)33-29(36)23-15-13-12-14-16-23/h12-18,24-25,27-28H,8-11,19-22H2,1-7H3,(H,33,34,36,37)/t24-,25-,27-,28?/m1/s1 |
| InChIKey | QCBRZHIIQOLTFX-AUTNKXAOSA-N |
| XLogP | 7.54 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.81 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|