C18H20FN3O3 — CID 58060772
N-[1-[6-(deuteriomethyl)-4-fluoro-5-methyloxan-3-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 58060772) has the molecular formula C18H20FN3O3 and a molecular weight of 346.38 g/mol. Its IUPAC name is N-[1-[6-(deuteriomethyl)-4-fluoro-5-methyloxan-3-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[6-(deuteriomethyl)-4-fluoro-5-methyloxan-3-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 58060772 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-[1-[6-(deuteriomethyl)-4-fluoro-5-methyloxan-3-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | [2H]CC1OCC(n2ccc(NC(=O)c3ccccc3)nc2=O)C(F)C1C |
| InChI | InChI=1S/C18H20FN3O3/c1-11-12(2)25-10-14(16(11)19)22-9-8-15(21-18(22)24)20-17(23)13-6-4-3-5-7-13/h3-9,11-12,14,16H,10H2,1-2H3,(H,20,21,23,24)/i2D |
| InChIKey | MPCBZTZKXQCYAX-VMNATFBRSA-N |
| XLogP | 2.43 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |