C17H14FN3O4 — CID 45102696
N-[1-(4-fluoro-6-methyl-5-oxo-2H-pyran-2-yl)-2-oxopyrimidin-4-yl]benzamide (PubChem CID 45102696) has the molecular formula C17H14FN3O4 and a molecular weight of 343.31 g/mol. Its IUPAC name is N-[1-(4-fluoro-6-methyl-5-oxo-2H-pyran-2-yl)-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-(4-fluoro-6-methyl-5-oxo-2H-pyran-2-yl)-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 45102696 |
| Molecular Formula | C17H14FN3O4 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-[1-(4-fluoro-6-methyl-5-oxo-2H-pyran-2-yl)-2-oxopyrimidin-4-yl]benzamide |
| SMILES | CC1OC(n2ccc(NC(=O)c3ccccc3)nc2=O)C=C(F)C1=O |
| InChI | InChI=1S/C17H14FN3O4/c1-10-15(22)12(18)9-14(25-10)21-8-7-13(20-17(21)24)19-16(23)11-5-3-2-4-6-11/h2-10,14H,1H3,(H,19,20,23,24) |
| InChIKey | HNJXFNLVLBSSLN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|