C21H20N2O — CID 110373393
N-ethyl-N,2-diphenyl-2-pyridin-2-ylacetamide (PubChem CID 110373393) has the molecular formula C21H20N2O and a molecular weight of 316.40 g/mol. Its IUPAC name is N-ethyl-N,2-diphenyl-2-pyridin-2-ylacetamide.
| Compound Name | N-ethyl-N,2-diphenyl-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 110373393 |
| Molecular Formula | C21H20N2O |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-ethyl-N,2-diphenyl-2-pyridin-2-ylacetamide |
| SMILES | CCN(C(=O)C(c1ccccc1)c1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O/c1-2-23(18-13-7-4-8-14-18)21(24)20(17-11-5-3-6-12-17)19-15-9-10-16-22-19/h3-16,20H,2H2,1H3 |
| InChIKey | QVLHNHANBBMYKA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |