C22H26N2O6 — CID 13004541
(Z)-but-2-enedioic acid;2-(dimethylamino)ethyl 2-anilino-2-phenylacetate (PubChem CID 13004541) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-(dimethylamino)ethyl 2-anilino-2-phenylacetate.
| Compound Name | (Z)-but-2-enedioic acid;2-(dimethylamino)ethyl 2-anilino-2-phenylacetate |
|---|---|
| PubChem CID | 13004541 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-(dimethylamino)ethyl 2-anilino-2-phenylacetate |
| SMILES | CN(C)CCOC(=O)C(Nc1ccccc1)c1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C18H22N2O2.C4H4O4/c1-20(2)13-14-22-18(21)17(15-9-5-3-6-10-15)19-16-11-7-4-8-12-16;5-3(6)1-2-4(7)8/h3-12,17,19H,13-14H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | FCKPPISHFGDBCG-BTJKTKAUSA-N |
| XLogP | 2.66 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|