C22H25N3O5-2 — CID 20840996
2-anilino-N-[2-(dimethylamino)ethyl]-2-phenylacetamide;(Z)-but-2-enedioate (PubChem CID 20840996) has the molecular formula C22H25N3O5-2 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-anilino-N-[2-(dimethylamino)ethyl]-2-phenylacetamide;(Z)-but-2-enedioate.
| Compound Name | 2-anilino-N-[2-(dimethylamino)ethyl]-2-phenylacetamide;(Z)-but-2-enedioate |
|---|---|
| PubChem CID | 20840996 |
| Molecular Formula | C22H25N3O5-2 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-anilino-N-[2-(dimethylamino)ethyl]-2-phenylacetamide;(Z)-but-2-enedioate |
| SMILES | CN(C)CCNC(=O)C(Nc1ccccc1)c1ccccc1.O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/C18H23N3O.C4H4O4/c1-21(2)14-13-19-18(22)17(15-9-5-3-6-10-15)20-16-11-7-4-8-12-16;5-3(6)1-2-4(7)8/h3-12,17,20H,13-14H2,1-2H3,(H,19,22);1-2H,(H,5,6)(H,7,8)/p-2/b;2-1- |
| InChIKey | QKROQEVBGMYROE-BTJKTKAUSA-L |
| XLogP | -0.44 |
| TPSA | 124.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|