About chloromethyl 2-methylpent-2-enoate
chloromethyl 2-methylpent-2-enoate (PubChem CID 174869785) has the molecular formula C7H11ClO2
and a molecular weight of 162.62 g/mol. Its IUPAC name is chloromethyl 2-methylpent-2-enoate.
Molecular Properties
| Compound Name | chloromethyl 2-methylpent-2-enoate |
| PubChem CID | 174869785 |
| Molecular Formula | C7H11ClO2 |
| Molecular Weight | 162.62 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | chloromethyl 2-methylpent-2-enoate |
| SMILES | CCC=C(C)C(=O)OCCl |
| InChI | InChI=1S/C7H11ClO2/c1-3-4-6(2)7(9)10-5-8/h4H,3,5H2,1-2H3 |
| InChIKey | RVIRVSFSQYRHRH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.62 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze chloromethyl 2-methylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethyl 2-methylpent-2-enoate?
The IUPAC name of chloromethyl 2-methylpent-2-enoate (CID 174869785) is chloromethyl 2-methylpent-2-enoate.
What is the SMILES notation for chloromethyl 2-methylpent-2-enoate?
The canonical SMILES for chloromethyl 2-methylpent-2-enoate is CCC=C(C)C(=O)OCCl.
What is the InChIKey of chloromethyl 2-methylpent-2-enoate?
The InChIKey is RVIRVSFSQYRHRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClO2/c1-3-4-6(2)7(9)10-5-8/h4H,3,5H2,1-2H3.
What are the key properties of chloromethyl 2-methylpent-2-enoate?
chloromethyl 2-methylpent-2-enoate has a molecular weight of 162.62 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethyl 2-methylpent-2-enoate is sourced from PubChem (CID 174869785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).