About (carbamoylamino) 2-methylpent-2-enoate
(carbamoylamino) 2-methylpent-2-enoate (PubChem CID 173054896) has the molecular formula C7H12N2O3
and a molecular weight of 172.18 g/mol. Its IUPAC name is (carbamoylamino) 2-methylpent-2-enoate.
Molecular Properties
| Compound Name | (carbamoylamino) 2-methylpent-2-enoate |
| PubChem CID | 173054896 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | (carbamoylamino) 2-methylpent-2-enoate |
| SMILES | CCC=C(C)C(=O)ONC(N)=O |
| InChI | InChI=1S/C7H12N2O3/c1-3-4-5(2)6(10)12-9-7(8)11/h4H,3H2,1-2H3,(H3,8,9,11) |
| InChIKey | DKBARTYYBPSIBU-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (carbamoylamino) 2-methylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (carbamoylamino) 2-methylpent-2-enoate?
The IUPAC name of (carbamoylamino) 2-methylpent-2-enoate (CID 173054896) is (carbamoylamino) 2-methylpent-2-enoate.
What is the SMILES notation for (carbamoylamino) 2-methylpent-2-enoate?
The canonical SMILES for (carbamoylamino) 2-methylpent-2-enoate is CCC=C(C)C(=O)ONC(N)=O.
What is the InChIKey of (carbamoylamino) 2-methylpent-2-enoate?
The InChIKey is DKBARTYYBPSIBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3/c1-3-4-5(2)6(10)12-9-7(8)11/h4H,3H2,1-2H3,(H3,8,9,11).
What are the key properties of (carbamoylamino) 2-methylpent-2-enoate?
(carbamoylamino) 2-methylpent-2-enoate has a molecular weight of 172.18 g/mol, XLogP of 0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (carbamoylamino) 2-methylpent-2-enoate is sourced from PubChem (CID 173054896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).