About 3-oxobutanoyl 2-methylpent-2-eneperoxoate
3-oxobutanoyl 2-methylpent-2-eneperoxoate (PubChem CID 135203619) has the molecular formula C20H28O10
and a molecular weight of 428.43 g/mol. Its IUPAC name is 3-oxobutanoyl 2-methylpent-2-eneperoxoate.
Molecular Properties
| Compound Name | 3-oxobutanoyl 2-methylpent-2-eneperoxoate |
| PubChem CID | 135203619 |
| Molecular Formula | C20H28O10 |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 3-oxobutanoyl 2-methylpent-2-eneperoxoate |
| SMILES | CCC=C(C)C(=O)OOC(=O)CC(C)=O.CCC=C(C)C(=O)OOC(=O)CC(C)=O |
| InChI | InChI=1S/2C10H14O5/c2*1-4-5-7(2)10(13)15-14-9(12)6-8(3)11/h2*5H,4,6H2,1-3H3 |
| InChIKey | HXRXEMGYVSIKBT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-oxobutanoyl 2-methylpent-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxobutanoyl 2-methylpent-2-eneperoxoate?
The IUPAC name of 3-oxobutanoyl 2-methylpent-2-eneperoxoate (CID 135203619) is 3-oxobutanoyl 2-methylpent-2-eneperoxoate.
What is the SMILES notation for 3-oxobutanoyl 2-methylpent-2-eneperoxoate?
The canonical SMILES for 3-oxobutanoyl 2-methylpent-2-eneperoxoate is CCC=C(C)C(=O)OOC(=O)CC(C)=O.CCC=C(C)C(=O)OOC(=O)CC(C)=O.
What is the InChIKey of 3-oxobutanoyl 2-methylpent-2-eneperoxoate?
The InChIKey is HXRXEMGYVSIKBT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H14O5/c2*1-4-5-7(2)10(13)15-14-9(12)6-8(3)11/h2*5H,4,6H2,1-3H3.
What are the key properties of 3-oxobutanoyl 2-methylpent-2-eneperoxoate?
3-oxobutanoyl 2-methylpent-2-eneperoxoate has a molecular weight of 428.43 g/mol, XLogP of 2.65, 8 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxobutanoyl 2-methylpent-2-eneperoxoate is sourced from PubChem (CID 135203619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).