C8H16O3Si — CID 154050270
1-methoxysilylpropan-2-yl 2-methylprop-2-enoate (PubChem CID 154050270) has the molecular formula C8H16O3Si and a molecular weight of 188.30 g/mol. Its IUPAC name is 1-methoxysilylpropan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1-methoxysilylpropan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154050270 |
| Molecular Formula | C8H16O3Si |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 1-methoxysilylpropan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)C[SiH2]OC |
| InChI | InChI=1S/C8H16O3Si/c1-6(2)8(9)11-7(3)5-12-10-4/h7H,1,5,12H2,2-4H3 |
| InChIKey | HZHLLENZWWYYER-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|