C10H27N3O3Si — CID 175895895
N'-[2-[deuterio(3-trimethoxysilylpropyl)amino]ethyl]ethane-1,2-diamine (PubChem CID 175895895) has the molecular formula C10H27N3O3Si and a molecular weight of 266.44 g/mol. Its IUPAC name is N'-[2-[deuterio(3-trimethoxysilylpropyl)amino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[deuterio(3-trimethoxysilylpropyl)amino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 175895895 |
| Molecular Formula | C10H27N3O3Si |
| Molecular Weight | 266.44 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | N'-[2-[deuterio(3-trimethoxysilylpropyl)amino]ethyl]ethane-1,2-diamine |
| SMILES | [2H]N(CCC[Si](OC)(OC)OC)CCNCCN |
| InChI | InChI=1S/C10H27N3O3Si/c1-14-17(15-2,16-3)10-4-6-12-8-9-13-7-5-11/h12-13H,4-11H2,1-3H3/i/hD |
| InChIKey | NHBRUUFBSBSTHM-DYCDLGHISA-N |
| XLogP | -0.61 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.44 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|