C9H23N3O3Si — CID 20651955
1-N'-(aminomethyl)-1-N-(3-trimethoxysilylpropyl)ethene-1,1-diamine (PubChem CID 20651955) has the molecular formula C9H23N3O3Si and a molecular weight of 249.39 g/mol. Its IUPAC name is 1-N'-(aminomethyl)-1-N-(3-trimethoxysilylpropyl)ethene-1,1-diamine.
| Compound Name | 1-N'-(aminomethyl)-1-N-(3-trimethoxysilylpropyl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 20651955 |
| Molecular Formula | C9H23N3O3Si |
| Molecular Weight | 249.39 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-N'-(aminomethyl)-1-N-(3-trimethoxysilylpropyl)ethene-1,1-diamine |
| SMILES | C=C(NCN)NCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C9H23N3O3Si/c1-9(12-8-10)11-6-5-7-16(13-2,14-3)15-4/h11-12H,1,5-8,10H2,2-4H3 |
| InChIKey | CKDUDSRQVRSJGJ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.39 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|