C8H20N4 — CID 22616707
N'-[1-(3-aminopropylamino)ethenyl]propane-1,3-diamine (PubChem CID 22616707) has the molecular formula C8H20N4 and a molecular weight of 172.28 g/mol. Its IUPAC name is N'-[1-(3-aminopropylamino)ethenyl]propane-1,3-diamine.
| Compound Name | N'-[1-(3-aminopropylamino)ethenyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 22616707 |
| Molecular Formula | C8H20N4 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.17 |
| IUPAC Name | N'-[1-(3-aminopropylamino)ethenyl]propane-1,3-diamine |
| SMILES | C=C(NCCCN)NCCCN |
| InChI | InChI=1S/C8H20N4/c1-8(11-6-2-4-9)12-7-3-5-10/h11-12H,1-7,9-10H2 |
| InChIKey | WIMQSBSKQCWJPX-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|