C9H20N2O3SSi — CID 140840932
1-ethenyl-3-(3-trimethoxysilylpropyl)thiourea (PubChem CID 140840932) has the molecular formula C9H20N2O3SSi and a molecular weight of 264.42 g/mol. Its IUPAC name is 1-ethenyl-3-(3-trimethoxysilylpropyl)thiourea.
| Compound Name | 1-ethenyl-3-(3-trimethoxysilylpropyl)thiourea |
|---|---|
| PubChem CID | 140840932 |
| Molecular Formula | C9H20N2O3SSi |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1-ethenyl-3-(3-trimethoxysilylpropyl)thiourea |
| SMILES | C=CNC(=S)NCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C9H20N2O3SSi/c1-5-10-9(15)11-7-6-8-16(12-2,13-3)14-4/h5H,1,6-8H2,2-4H3,(H2,10,11,15) |
| InChIKey | PBTXGXCRLGSNBW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|