C20H51N3O9Si4 — CID 71336651
N-[ethenyl-bis(3-trimethoxysilylpropylamino)silyl]-3-trimethoxysilylpropan-1-amine (PubChem CID 71336651) has the molecular formula C20H51N3O9Si4 and a molecular weight of 589.98 g/mol. Its IUPAC name is N-[ethenyl-bis(3-trimethoxysilylpropylamino)silyl]-3-trimethoxysilylpropan-1-amine.
| Compound Name | N-[ethenyl-bis(3-trimethoxysilylpropylamino)silyl]-3-trimethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 71336651 |
| Molecular Formula | C20H51N3O9Si4 |
| Molecular Weight | 589.98 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | N-[ethenyl-bis(3-trimethoxysilylpropylamino)silyl]-3-trimethoxysilylpropan-1-amine |
| SMILES | C=C[Si](NCCC[Si](OC)(OC)OC)(NCCC[Si](OC)(OC)OC)NCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C20H51N3O9Si4/c1-11-33(21-15-12-18-34(24-2,25-3)26-4,22-16-13-19-35(27-5,28-6)29-7)23-17-14-20-36(30-8,31-9)32-10/h11,21-23H,1,12-20H2,2-10H3 |
| InChIKey | UPECYJZYPVKELU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.98 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|