C9H22N2O3Si — CID 123494391
1,1-bis(2-hydroxyethyl)-3-(3-methylsilylpropyl)urea (PubChem CID 123494391) has the molecular formula C9H22N2O3Si and a molecular weight of 234.37 g/mol. Its IUPAC name is 1,1-bis(2-hydroxyethyl)-3-(3-methylsilylpropyl)urea.
| Compound Name | 1,1-bis(2-hydroxyethyl)-3-(3-methylsilylpropyl)urea |
|---|---|
| PubChem CID | 123494391 |
| Molecular Formula | C9H22N2O3Si |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1,1-bis(2-hydroxyethyl)-3-(3-methylsilylpropyl)urea |
| SMILES | C[SiH2]CCCNC(=O)N(CCO)CCO |
| InChI | InChI=1S/C9H22N2O3Si/c1-15-8-2-3-10-9(14)11(4-6-12)5-7-13/h12-13H,2-8,15H2,1H3,(H,10,14) |
| InChIKey | DKPYQPOUMBXYPN-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|