C15H24N2O4 — CID 108883758
1,1-bis(2-hydroxyethyl)-3-[3-(2-methylphenoxy)propyl]urea (PubChem CID 108883758) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 1,1-bis(2-hydroxyethyl)-3-[3-(2-methylphenoxy)propyl]urea.
| Compound Name | 1,1-bis(2-hydroxyethyl)-3-[3-(2-methylphenoxy)propyl]urea |
|---|---|
| PubChem CID | 108883758 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1,1-bis(2-hydroxyethyl)-3-[3-(2-methylphenoxy)propyl]urea |
| SMILES | Cc1ccccc1OCCCNC(=O)N(CCO)CCO |
| InChI | InChI=1S/C15H24N2O4/c1-13-5-2-3-6-14(13)21-12-4-7-16-15(20)17(8-10-18)9-11-19/h2-3,5-6,18-19H,4,7-12H2,1H3,(H,16,20) |
| InChIKey | BYCZWOKNCNTAPH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|