C11H28NO5Si2 — CID 153282899
CID 153282899 (PubChem CID 153282899) has the molecular formula C11H28NO5Si2 and a molecular weight of 310.52 g/mol.
| Compound Name | CID 153282899 |
|---|---|
| PubChem CID | 153282899 |
| Molecular Formula | C11H28NO5Si2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | — |
| SMILES | CO[Si](CCCNCCC[Si](OC)(OC)OC)OC |
| InChI | InChI=1S/C11H28NO5Si2/c1-13-18(14-2)10-6-8-12-9-7-11-19(15-3,16-4)17-5/h12H,6-11H2,1-5H3 |
| InChIKey | XPVFXTUYAURYSH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|