C16H23NO — CID 67763513
N,N-diethyl-4-(3-methoxypenta-1,4-dienyl)aniline (PubChem CID 67763513) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is N,N-diethyl-4-(3-methoxypenta-1,4-dienyl)aniline.
| Compound Name | N,N-diethyl-4-(3-methoxypenta-1,4-dienyl)aniline |
|---|---|
| PubChem CID | 67763513 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | N,N-diethyl-4-(3-methoxypenta-1,4-dienyl)aniline |
| SMILES | C=CC(C=Cc1ccc(N(CC)CC)cc1)OC |
| InChI | InChI=1S/C16H23NO/c1-5-16(18-4)13-10-14-8-11-15(12-9-14)17(6-2)7-3/h5,8-13,16H,1,6-7H2,2-4H3 |
| InChIKey | OJLGOXWWGTYPLE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|