C16H20N2OTe — CID 11825156
4-[4-(dimethylamino)phenyl]tellurinyl-N,N-dimethylaniline (PubChem CID 11825156) has the molecular formula C16H20N2OTe and a molecular weight of 383.95 g/mol. Its IUPAC name is 4-[4-(dimethylamino)phenyl]tellurinyl-N,N-dimethylaniline.
| Compound Name | 4-[4-(dimethylamino)phenyl]tellurinyl-N,N-dimethylaniline |
|---|---|
| PubChem CID | 11825156 |
| Molecular Formula | C16H20N2OTe |
| Molecular Weight | 383.95 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 4-[4-(dimethylamino)phenyl]tellurinyl-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc([Te](=O)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C16H20N2OTe/c1-17(2)13-5-9-15(10-6-13)20(19)16-11-7-14(8-12-16)18(3)4/h5-12H,1-4H3 |
| InChIKey | WEMBVXTTWZTKCE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.95 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|