C17H19IN2 — CID 91871787
4-[(E)-4-iodo-3-pyridin-2-ylbut-1-enyl]-N,N-dimethylaniline (PubChem CID 91871787) has the molecular formula C17H19IN2 and a molecular weight of 378.26 g/mol. Its IUPAC name is 4-[(E)-4-iodo-3-pyridin-2-ylbut-1-enyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-4-iodo-3-pyridin-2-ylbut-1-enyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 91871787 |
| Molecular Formula | C17H19IN2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 4-[(E)-4-iodo-3-pyridin-2-ylbut-1-enyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/C(CI)c2ccccn2)cc1 |
| InChI | InChI=1S/C17H19IN2/c1-20(2)16-10-7-14(8-11-16)6-9-15(13-18)17-5-3-4-12-19-17/h3-12,15H,13H2,1-2H3/b9-6+ |
| InChIKey | OUYDUFRBQMVQGF-RMKNXTFCSA-N |
| XLogP | 4.38 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|