C28H15N3O2S — CID 170175263
2-[(2Z)-3-hydroxy-2-[(2-naphthalen-2-ylfuro[2,3-d][1,3]thiazol-5-yl)methylidene]-3H-inden-1-ylidene]propanedinitrile (PubChem CID 170175263) has the molecular formula C28H15N3O2S and a molecular weight of 457.51 g/mol. Its IUPAC name is 2-[(2Z)-3-hydroxy-2-[(2-naphthalen-2-ylfuro[2,3-d][1,3]thiazol-5-yl)methylidene]-3H-inden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-3-hydroxy-2-[(2-naphthalen-2-ylfuro[2,3-d][1,3]thiazol-5-yl)methylidene]-3H-inden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 170175263 |
| Molecular Formula | C28H15N3O2S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 2-[(2Z)-3-hydroxy-2-[(2-naphthalen-2-ylfuro[2,3-d][1,3]thiazol-5-yl)methylidene]-3H-inden-1-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1/C(=C/c2cc3sc(-c4ccc5ccccc5c4)nc3o2)C(O)c2ccccc21 |
| InChI | InChI=1S/C28H15N3O2S/c29-14-19(15-30)25-21-7-3-4-8-22(21)26(32)23(25)12-20-13-24-27(33-20)31-28(34-24)18-10-9-16-5-1-2-6-17(16)11-18/h1-13,26,32H/b23-12- |
| InChIKey | MLUAAXANFPCHRT-FMCGGJTJSA-N |
| XLogP | 6.64 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|