C23H12Br2O4 — CID 59061349
5-bromo-2-[5-(5-bromo-3-hydroxy-1-oxoinden-2-yl)penta-2,4-dienylidene]indene-1,3-dione (PubChem CID 59061349) has the molecular formula C23H12Br2O4 and a molecular weight of 512.15 g/mol. Its IUPAC name is 5-bromo-2-[5-(5-bromo-3-hydroxy-1-oxoinden-2-yl)penta-2,4-dienylidene]indene-1,3-dione.
| Compound Name | 5-bromo-2-[5-(5-bromo-3-hydroxy-1-oxoinden-2-yl)penta-2,4-dienylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 59061349 |
| Molecular Formula | C23H12Br2O4 |
| Molecular Weight | 512.15 g/mol |
| Exact Mass | 509.91 |
| IUPAC Name | 5-bromo-2-[5-(5-bromo-3-hydroxy-1-oxoinden-2-yl)penta-2,4-dienylidene]indene-1,3-dione |
| SMILES | O=C1C(=CC=CC=CC2=C(O)c3cc(Br)ccc3C2=O)C(=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C23H12Br2O4/c24-12-6-8-14-18(10-12)22(28)16(20(14)26)4-2-1-3-5-17-21(27)15-9-7-13(25)11-19(15)23(17)29/h1-11,28H |
| InChIKey | SJFFYFQUBUBUTN-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.15 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|