C31H32O4 — CID 158552150
5-tert-butyl-2-[5-(3-hydroxy-5-methyl-1-oxoinden-2-yl)penta-2,4-dienylidene]indene-1,3-dione;propane (PubChem CID 158552150) has the molecular formula C31H32O4 and a molecular weight of 468.59 g/mol. Its IUPAC name is 5-tert-butyl-2-[5-(3-hydroxy-5-methyl-1-oxoinden-2-yl)penta-2,4-dienylidene]indene-1,3-dione;propane.
| Compound Name | 5-tert-butyl-2-[5-(3-hydroxy-5-methyl-1-oxoinden-2-yl)penta-2,4-dienylidene]indene-1,3-dione;propane |
|---|---|
| PubChem CID | 158552150 |
| Molecular Formula | C31H32O4 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 5-tert-butyl-2-[5-(3-hydroxy-5-methyl-1-oxoinden-2-yl)penta-2,4-dienylidene]indene-1,3-dione;propane |
| SMILES | CCC.Cc1ccc2c(c1)C(O)=C(C=CC=CC=C1C(=O)c3ccc(C(C)(C)C)cc3C1=O)C2=O |
| InChI | InChI=1S/C28H24O4.C3H8/c1-16-10-12-18-22(14-16)26(31)20(24(18)29)8-6-5-7-9-21-25(30)19-13-11-17(28(2,3)4)15-23(19)27(21)32;1-3-2/h5-15,31H,1-4H3;3H2,1-2H3 |
| InChIKey | LVUBQPYHSARMQY-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|