C50H56O8 — CID 132769838
3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-6-methylnaphthalene-1,2-dione;3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-7-methylnaphthalene-1,2-dione (PubChem CID 132769838) has the molecular formula C50H56O8 and a molecular weight of 784.99 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-6-methylnaphthalene-1,2-dione;3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-7-methylnaphthalene-1,2-dione.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-6-methylnaphthalene-1,2-dione;3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-7-methylnaphthalene-1,2-dione |
|---|---|
| PubChem CID | 132769838 |
| Molecular Formula | C50H56O8 |
| Molecular Weight | 784.99 g/mol |
| Exact Mass | 784.40 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-6-methylnaphthalene-1,2-dione;3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-7-methylnaphthalene-1,2-dione |
| SMILES | Cc1ccc2c(c1)C(=O)C(=O)C(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)=C2O.Cc1ccc2c(c1)C(O)=C(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)C2=O |
| InChI | InChI=1S/2C25H28O4/c1-13-8-9-15-16(10-13)20(26)19(23(29)21(15)27)14-11-17(24(2,3)4)22(28)18(12-14)25(5,6)7;1-13-8-9-15-16(10-13)21(27)23(29)19(20(15)26)14-11-17(24(2,3)4)22(28)18(12-14)25(5,6)7/h2*8-12,26,28H,1-7H3 |
| InChIKey | WOHFTFMCPVZWGJ-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.99 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|