C32H40O4 — CID 10345405
3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-5,5,8,8-tetramethyl-6,7-dihydroanthracene-1,2-dione (PubChem CID 10345405) has the molecular formula C32H40O4 and a molecular weight of 488.67 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-5,5,8,8-tetramethyl-6,7-dihydroanthracene-1,2-dione.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-5,5,8,8-tetramethyl-6,7-dihydroanthracene-1,2-dione |
|---|---|
| PubChem CID | 10345405 |
| Molecular Formula | C32H40O4 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-4-hydroxy-5,5,8,8-tetramethyl-6,7-dihydroanthracene-1,2-dione |
| SMILES | CC(C)(C)c1cc(C2=C(O)c3cc4c(cc3C(=O)C2=O)C(C)(C)CCC4(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C32H40O4/c1-29(2,3)22-13-17(14-23(27(22)35)30(4,5)6)24-25(33)18-15-20-21(16-19(18)26(34)28(24)36)32(9,10)12-11-31(20,7)8/h13-16,33,35H,11-12H2,1-10H3 |
| InChIKey | YOTYAJCSZGXMIB-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|