C25H28O3 — CID 11728526
2-(3,5-ditert-butyl-4-hydroxyphenyl)-6-methylnaphthalene-1,4-dione (PubChem CID 11728526) has the molecular formula C25H28O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-(3,5-ditert-butyl-4-hydroxyphenyl)-6-methylnaphthalene-1,4-dione.
| Compound Name | 2-(3,5-ditert-butyl-4-hydroxyphenyl)-6-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 11728526 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2-(3,5-ditert-butyl-4-hydroxyphenyl)-6-methylnaphthalene-1,4-dione |
| SMILES | Cc1ccc2c(c1)C(=O)C=C(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C2=O |
| InChI | InChI=1S/C25H28O3/c1-14-8-9-16-18(10-14)21(26)13-17(22(16)27)15-11-19(24(2,3)4)23(28)20(12-15)25(5,6)7/h8-13,28H,1-7H3 |
| InChIKey | JPVQHXUOIYABQQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|