C38H32O4 — CID 89108225
3-[[(E,3E)-3-[3-[(E)-2-(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]prop-1-enoxy]methyl]naphthalene-2-carbaldehyde (PubChem CID 89108225) has the molecular formula C38H32O4 and a molecular weight of 552.67 g/mol. Its IUPAC name is 3-[[(E,3E)-3-[3-[(E)-2-(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]prop-1-enoxy]methyl]naphthalene-2-carbaldehyde.
| Compound Name | 3-[[(E,3E)-3-[3-[(E)-2-(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]prop-1-enoxy]methyl]naphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 89108225 |
| Molecular Formula | C38H32O4 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 3-[[(E,3E)-3-[3-[(E)-2-(1-hydroxy-3-oxocyclopenta[b]naphthalen-2-yl)ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]prop-1-enoxy]methyl]naphthalene-2-carbaldehyde |
| SMILES | CC1(C)CC(/C=C/C2=C(O)c3cc4ccccc4cc3C2=O)=C/C(=C/C=C/OCc2cc3ccccc3cc2C=O)C1 |
| InChI | InChI=1S/C38H32O4/c1-38(2)21-25(8-7-15-42-24-32-18-28-10-4-3-9-27(28)17-31(32)23-39)16-26(22-38)13-14-33-36(40)34-19-29-11-5-6-12-30(29)20-35(34)37(33)41/h3-20,23,40H,21-22,24H2,1-2H3/b14-13+,15-7+,25-8- |
| InChIKey | XDTDDLDDJYQDKJ-WWCNTMOCSA-N |
| XLogP | 9.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|