C27H20N2O6 — CID 91157190
N-[2-[5-(5-acetamido-1,3-dioxoinden-2-ylidene)pent-3-enylidene]-1,3-dioxoinden-5-yl]acetamide (PubChem CID 91157190) has the molecular formula C27H20N2O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is N-[2-[5-(5-acetamido-1,3-dioxoinden-2-ylidene)pent-3-enylidene]-1,3-dioxoinden-5-yl]acetamide.
| Compound Name | N-[2-[5-(5-acetamido-1,3-dioxoinden-2-ylidene)pent-3-enylidene]-1,3-dioxoinden-5-yl]acetamide |
|---|---|
| PubChem CID | 91157190 |
| Molecular Formula | C27H20N2O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | N-[2-[5-(5-acetamido-1,3-dioxoinden-2-ylidene)pent-3-enylidene]-1,3-dioxoinden-5-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)C(=O)C(=CC=CCC=C1C(=O)c3ccc(NC(C)=O)cc3C1=O)C2=O |
| InChI | InChI=1S/C27H20N2O6/c1-14(30)28-16-8-10-18-22(12-16)26(34)20(24(18)32)6-4-3-5-7-21-25(33)19-11-9-17(29-15(2)31)13-23(19)27(21)35/h3-4,6-13H,5H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | UUSHLVQOCAHTHY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|