C21H24N4O5 — CID 72696869
2-(2-hydroxyethylamino)-N-[7-[[2-(2-hydroxyethylamino)acetyl]amino]-9-oxofluoren-2-yl]acetamide (PubChem CID 72696869) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)-N-[7-[[2-(2-hydroxyethylamino)acetyl]amino]-9-oxofluoren-2-yl]acetamide.
| Compound Name | 2-(2-hydroxyethylamino)-N-[7-[[2-(2-hydroxyethylamino)acetyl]amino]-9-oxofluoren-2-yl]acetamide |
|---|---|
| PubChem CID | 72696869 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-(2-hydroxyethylamino)-N-[7-[[2-(2-hydroxyethylamino)acetyl]amino]-9-oxofluoren-2-yl]acetamide |
| SMILES | O=C(CNCCO)Nc1ccc2c(c1)C(=O)c1cc(NC(=O)CNCCO)ccc1-2 |
| InChI | InChI=1S/C21H24N4O5/c26-7-5-22-11-19(28)24-13-1-3-15-16-4-2-14(25-20(29)12-23-6-8-27)10-18(16)21(30)17(15)9-13/h1-4,9-10,22-23,26-27H,5-8,11-12H2,(H,24,28)(H,25,29) |
| InChIKey | LBLCEFQLZNHZDT-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|