C15H19N5O2S — CID 713698
2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-1-piperidin-1-ylethanone (PubChem CID 713698) has the molecular formula C15H19N5O2S and a molecular weight of 333.42 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-1-piperidin-1-ylethanone.
| Compound Name | 2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 713698 |
| Molecular Formula | C15H19N5O2S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanyl-1-piperidin-1-ylethanone |
| SMILES | COc1ccc(-n2nnnc2SCC(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C15H19N5O2S/c1-22-13-7-5-12(6-8-13)20-15(16-17-18-20)23-11-14(21)19-9-3-2-4-10-19/h5-8H,2-4,9-11H2,1H3 |
| InChIKey | CCIVHCFPMXROCG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |