C16H19ClN6O4S — CID 146087102
5-chloro-2-methoxy-N'-[2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]benzohydrazide (PubChem CID 146087102) has the molecular formula C16H19ClN6O4S and a molecular weight of 426.89 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N'-[2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]benzohydrazide.
| Compound Name | 5-chloro-2-methoxy-N'-[2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]benzohydrazide |
|---|---|
| PubChem CID | 146087102 |
| Molecular Formula | C16H19ClN6O4S |
| Molecular Weight | 426.89 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 5-chloro-2-methoxy-N'-[2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]benzohydrazide |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)CSc1nnnn1CC1CCCO1 |
| InChI | InChI=1S/C16H19ClN6O4S/c1-26-13-5-4-10(17)7-12(13)15(25)19-18-14(24)9-28-16-20-21-22-23(16)8-11-3-2-6-27-11/h4-5,7,11H,2-3,6,8-9H2,1H3,(H,18,24)(H,19,25) |
| InChIKey | FULMXZPNYQAQHF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.89 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|