C16H20N6O4S — CID 46640592
N-[(4-methoxyphenyl)carbamoyl]-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 46640592) has the molecular formula C16H20N6O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)carbamoyl]-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[(4-methoxyphenyl)carbamoyl]-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 46640592 |
| Molecular Formula | C16H20N6O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-[(4-methoxyphenyl)carbamoyl]-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | COc1ccc(NC(=O)NC(=O)CSc2nnnn2CC2CCCO2)cc1 |
| InChI | InChI=1S/C16H20N6O4S/c1-25-12-6-4-11(5-7-12)17-15(24)18-14(23)10-27-16-19-20-21-22(16)9-13-3-2-8-26-13/h4-7,13H,2-3,8-10H2,1H3,(H2,17,18,23,24) |
| InChIKey | IETZSZBQQFJKIA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |