C19H28N6O3S — CID 27114531
N-(1-adamantylcarbamoyl)-2-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]sulfanylacetamide (PubChem CID 27114531) has the molecular formula C19H28N6O3S and a molecular weight of 420.54 g/mol. Its IUPAC name is N-(1-adamantylcarbamoyl)-2-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(1-adamantylcarbamoyl)-2-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 27114531 |
| Molecular Formula | C19H28N6O3S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | N-(1-adamantylcarbamoyl)-2-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1C[C@H]1CCCO1)NC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H28N6O3S/c26-16(11-29-18-22-23-24-25(18)10-15-2-1-3-28-15)20-17(27)21-19-7-12-4-13(8-19)6-14(5-12)9-19/h12-15H,1-11H2,(H2,20,21,26,27)/t12?,13?,14?,15-,19?/m1/s1 |
| InChIKey | ZXAZQTKDBBCVEO-BCFZYGEVSA-N |
| XLogP | 1.74 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |