C20H30N6O3S — CID 55442184
N-(1-adamantylcarbamoyl)-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 55442184) has the molecular formula C20H30N6O3S and a molecular weight of 434.57 g/mol. Its IUPAC name is N-(1-adamantylcarbamoyl)-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-(1-adamantylcarbamoyl)-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 55442184 |
| Molecular Formula | C20H30N6O3S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | N-(1-adamantylcarbamoyl)-2-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nnnn1CC1CCCO1)C(=O)NC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H30N6O3S/c1-12(30-19-23-24-25-26(19)11-16-3-2-4-29-16)17(27)21-18(28)22-20-8-13-5-14(9-20)7-15(6-13)10-20/h12-16H,2-11H2,1H3,(H2,21,22,27,28) |
| InChIKey | KVBVNTGBYKOLBY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |