C21H23N5O2S — CID 41119437
(2R)-2-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]sulfanyl-N-(2-phenylphenyl)propanamide (PubChem CID 41119437) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is (2R)-2-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]sulfanyl-N-(2-phenylphenyl)propanamide.
| Compound Name | (2R)-2-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]sulfanyl-N-(2-phenylphenyl)propanamide |
|---|---|
| PubChem CID | 41119437 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (2R)-2-[1-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]sulfanyl-N-(2-phenylphenyl)propanamide |
| SMILES | C[C@@H](Sc1nnnn1C[C@H]1CCCO1)C(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C21H23N5O2S/c1-15(29-21-23-24-25-26(21)14-17-10-7-13-28-17)20(27)22-19-12-6-5-11-18(19)16-8-3-2-4-9-16/h2-6,8-9,11-12,15,17H,7,10,13-14H2,1H3,(H,22,27)/t15-,17-/m1/s1 |
| InChIKey | LVKGUJSTWCAHRG-NVXWUHKLSA-N |
| XLogP | 3.64 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |